C17H20FN — CID 107130176
1-(3-fluoro-4-methylphenyl)-3-(3-methylphenyl)propan-1-amine (PubChem CID 107130176) has the molecular formula C17H20FN and a molecular weight of 257.35 g/mol. Its IUPAC name is 1-(3-fluoro-4-methylphenyl)-3-(3-methylphenyl)propan-1-amine.
| Compound Name | 1-(3-fluoro-4-methylphenyl)-3-(3-methylphenyl)propan-1-amine |
|---|---|
| PubChem CID | 107130176 |
| Molecular Formula | C17H20FN |
| Molecular Weight | 257.35 g/mol |
| Exact Mass | 257.16 |
| IUPAC Name | 1-(3-fluoro-4-methylphenyl)-3-(3-methylphenyl)propan-1-amine |
| SMILES | Cc1cccc(CCC(N)c2ccc(C)c(F)c2)c1 |
| InChI | InChI=1S/C17H20FN/c1-12-4-3-5-14(10-12)7-9-17(19)15-8-6-13(2)16(18)11-15/h3-6,8,10-11,17H,7,9,19H2,1-2H3 |
| InChIKey | RWUNKPPXMMYSAD-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.35 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |