C13H17N3O2S — CID 105305100
[(2,5-dimethoxyphenyl)-(2-methyl-1,3-thiazol-4-yl)methyl]hydrazine (PubChem CID 105305100) has the molecular formula C13H17N3O2S and a molecular weight of 279.37 g/mol. Its IUPAC name is [(2,5-dimethoxyphenyl)-(2-methyl-1,3-thiazol-4-yl)methyl]hydrazine.
| Compound Name | [(2,5-dimethoxyphenyl)-(2-methyl-1,3-thiazol-4-yl)methyl]hydrazine |
|---|---|
| PubChem CID | 105305100 |
| Molecular Formula | C13H17N3O2S |
| Molecular Weight | 279.37 g/mol |
| Exact Mass | 279.10 |
| IUPAC Name | [(2,5-dimethoxyphenyl)-(2-methyl-1,3-thiazol-4-yl)methyl]hydrazine |
| SMILES | COc1ccc(OC)c(C(NN)c2csc(C)n2)c1 |
| InChI | InChI=1S/C13H17N3O2S/c1-8-15-11(7-19-8)13(16-14)10-6-9(17-2)4-5-12(10)18-3/h4-7,13,16H,14H2,1-3H3 |
| InChIKey | KDTHELWLXDYZLX-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 69.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.37 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|