C27H31ClF3N5O2 — CID 10530686
8-chloro-N,N-dimethyl-4-[3-[4-[2-(2,2,2-trifluoroethoxy)phenyl]piperazin-1-yl]propylamino]quinoline-3-carboxamide (PubChem CID 10530686) has the molecular formula C27H31ClF3N5O2 and a molecular weight of 550.03 g/mol. Its IUPAC name is 8-chloro-N,N-dimethyl-4-[3-[4-[2-(2,2,2-trifluoroethoxy)phenyl]piperazin-1-yl]propylamino]quinoline-3-carboxamide.
| Compound Name | 8-chloro-N,N-dimethyl-4-[3-[4-[2-(2,2,2-trifluoroethoxy)phenyl]piperazin-1-yl]propylamino]quinoline-3-carboxamide |
|---|---|
| PubChem CID | 10530686 |
| Molecular Formula | C27H31ClF3N5O2 |
| Molecular Weight | 550.03 g/mol |
| Exact Mass | 549.21 |
| IUPAC Name | 8-chloro-N,N-dimethyl-4-[3-[4-[2-(2,2,2-trifluoroethoxy)phenyl]piperazin-1-yl]propylamino]quinoline-3-carboxamide |
| SMILES | CN(C)C(=O)c1cnc2c(Cl)cccc2c1NCCCN1CCN(c2ccccc2OCC(F)(F)F)CC1 |
| InChI | InChI=1S/C27H31ClF3N5O2/c1-34(2)26(37)20-17-33-25-19(7-5-8-21(25)28)24(20)32-11-6-12-35-13-15-36(16-14-35)22-9-3-4-10-23(22)38-18-27(29,30)31/h3-5,7-10,17H,6,11-16,18H2,1-2H3,(H,32,33) |
| InChIKey | GCDVKULSRAUNGQ-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 60.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.03 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|