C13H16ClFN4 — CID 105307653
[(2-chloro-3-fluorophenyl)-(1-propylimidazol-2-yl)methyl]hydrazine (PubChem CID 105307653) has the molecular formula C13H16ClFN4 and a molecular weight of 282.75 g/mol. Its IUPAC name is [(2-chloro-3-fluorophenyl)-(1-propylimidazol-2-yl)methyl]hydrazine.
| Compound Name | [(2-chloro-3-fluorophenyl)-(1-propylimidazol-2-yl)methyl]hydrazine |
|---|---|
| PubChem CID | 105307653 |
| Molecular Formula | C13H16ClFN4 |
| Molecular Weight | 282.75 g/mol |
| Exact Mass | 282.10 |
| IUPAC Name | [(2-chloro-3-fluorophenyl)-(1-propylimidazol-2-yl)methyl]hydrazine |
| SMILES | CCCn1ccnc1C(NN)c1cccc(F)c1Cl |
| InChI | InChI=1S/C13H16ClFN4/c1-2-7-19-8-6-17-13(19)12(18-16)9-4-3-5-10(15)11(9)14/h3-6,8,12,18H,2,7,16H2,1H3 |
| InChIKey | FYMOKSNNWSJKQW-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 55.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.75 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|