C12H16FN5 — CID 105257823
[(3-fluoro-2-pyridinyl)-(1-propylimidazol-2-yl)methyl]hydrazine (PubChem CID 105257823) has the molecular formula C12H16FN5 and a molecular weight of 249.29 g/mol. Its IUPAC name is [(3-fluoro-2-pyridinyl)-(1-propylimidazol-2-yl)methyl]hydrazine.
| Compound Name | [(3-fluoro-2-pyridinyl)-(1-propylimidazol-2-yl)methyl]hydrazine |
|---|---|
| PubChem CID | 105257823 |
| Molecular Formula | C12H16FN5 |
| Molecular Weight | 249.29 g/mol |
| Exact Mass | 249.14 |
| IUPAC Name | [(3-fluoro-2-pyridinyl)-(1-propylimidazol-2-yl)methyl]hydrazine |
| SMILES | CCCn1ccnc1C(NN)c1ncccc1F |
| InChI | InChI=1S/C12H16FN5/c1-2-7-18-8-6-16-12(18)11(17-14)10-9(13)4-3-5-15-10/h3-6,8,11,17H,2,7,14H2,1H3 |
| InChIKey | ISVHUSSVMMNMOI-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.29 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|