C8H14F2N4 — CID 105265098
[2,2-difluoro-1-(1-propylimidazol-2-yl)ethyl]hydrazine (PubChem CID 105265098) has the molecular formula C8H14F2N4 and a molecular weight of 204.22 g/mol. Its IUPAC name is [2,2-difluoro-1-(1-propylimidazol-2-yl)ethyl]hydrazine.
| Compound Name | [2,2-difluoro-1-(1-propylimidazol-2-yl)ethyl]hydrazine |
|---|---|
| PubChem CID | 105265098 |
| Molecular Formula | C8H14F2N4 |
| Molecular Weight | 204.22 g/mol |
| Exact Mass | 204.12 |
| IUPAC Name | [2,2-difluoro-1-(1-propylimidazol-2-yl)ethyl]hydrazine |
| SMILES | CCCn1ccnc1C(NN)C(F)F |
| InChI | InChI=1S/C8H14F2N4/c1-2-4-14-5-3-12-8(14)6(13-11)7(9)10/h3,5-7,13H,2,4,11H2,1H3 |
| InChIKey | FDRZFIOBUBCLIZ-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 55.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.22 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|