C9H18N4S — CID 105213893
[2-methylsulfanyl-1-(1-propylimidazol-2-yl)ethyl]hydrazine (PubChem CID 105213893) has the molecular formula C9H18N4S and a molecular weight of 214.34 g/mol. Its IUPAC name is [2-methylsulfanyl-1-(1-propylimidazol-2-yl)ethyl]hydrazine.
| Compound Name | [2-methylsulfanyl-1-(1-propylimidazol-2-yl)ethyl]hydrazine |
|---|---|
| PubChem CID | 105213893 |
| Molecular Formula | C9H18N4S |
| Molecular Weight | 214.34 g/mol |
| Exact Mass | 214.13 |
| IUPAC Name | [2-methylsulfanyl-1-(1-propylimidazol-2-yl)ethyl]hydrazine |
| SMILES | CCCn1ccnc1C(CSC)NN |
| InChI | InChI=1S/C9H18N4S/c1-3-5-13-6-4-11-9(13)8(12-10)7-14-2/h4,6,8,12H,3,5,7,10H2,1-2H3 |
| InChIKey | HQEAXMAJPMFTIX-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 55.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.34 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|