C12H23N3S — CID 105148894
N-ethyl-3-methylsulfanyl-1-(1-propylimidazol-2-yl)propan-1-amine (PubChem CID 105148894) has the molecular formula C12H23N3S and a molecular weight of 241.40 g/mol. Its IUPAC name is N-ethyl-3-methylsulfanyl-1-(1-propylimidazol-2-yl)propan-1-amine.
| Compound Name | N-ethyl-3-methylsulfanyl-1-(1-propylimidazol-2-yl)propan-1-amine |
|---|---|
| PubChem CID | 105148894 |
| Molecular Formula | C12H23N3S |
| Molecular Weight | 241.40 g/mol |
| Exact Mass | 241.16 |
| IUPAC Name | N-ethyl-3-methylsulfanyl-1-(1-propylimidazol-2-yl)propan-1-amine |
| SMILES | CCCn1ccnc1C(CCSC)NCC |
| InChI | InChI=1S/C12H23N3S/c1-4-8-15-9-7-14-12(15)11(13-5-2)6-10-16-3/h7,9,11,13H,4-6,8,10H2,1-3H3 |
| InChIKey | MQEDVQAHUHSJJW-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.40 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |