C13H25N3S — CID 65135355
N-methyl-2-(2-methylpropylsulfanyl)-1-(1-propylimidazol-2-yl)ethanamine (PubChem CID 65135355) has the molecular formula C13H25N3S and a molecular weight of 255.43 g/mol. Its IUPAC name is N-methyl-2-(2-methylpropylsulfanyl)-1-(1-propylimidazol-2-yl)ethanamine.
| Compound Name | N-methyl-2-(2-methylpropylsulfanyl)-1-(1-propylimidazol-2-yl)ethanamine |
|---|---|
| PubChem CID | 65135355 |
| Molecular Formula | C13H25N3S |
| Molecular Weight | 255.43 g/mol |
| Exact Mass | 255.18 |
| IUPAC Name | N-methyl-2-(2-methylpropylsulfanyl)-1-(1-propylimidazol-2-yl)ethanamine |
| SMILES | CCCn1ccnc1C(CSCC(C)C)NC |
| InChI | InChI=1S/C13H25N3S/c1-5-7-16-8-6-15-13(16)12(14-4)10-17-9-11(2)3/h6,8,11-12,14H,5,7,9-10H2,1-4H3 |
| InChIKey | NEVQXTLXSOOLEM-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.43 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |