C9H18N4O2 — CID 105245886
[1-(1-ethylimidazol-2-yl)-2,2-dimethoxyethyl]hydrazine (PubChem CID 105245886) has the molecular formula C9H18N4O2 and a molecular weight of 214.27 g/mol. Its IUPAC name is [1-(1-ethylimidazol-2-yl)-2,2-dimethoxyethyl]hydrazine.
| Compound Name | [1-(1-ethylimidazol-2-yl)-2,2-dimethoxyethyl]hydrazine |
|---|---|
| PubChem CID | 105245886 |
| Molecular Formula | C9H18N4O2 |
| Molecular Weight | 214.27 g/mol |
| Exact Mass | 214.14 |
| IUPAC Name | [1-(1-ethylimidazol-2-yl)-2,2-dimethoxyethyl]hydrazine |
| SMILES | CCn1ccnc1C(NN)C(OC)OC |
| InChI | InChI=1S/C9H18N4O2/c1-4-13-6-5-11-8(13)7(12-10)9(14-2)15-3/h5-7,9,12H,4,10H2,1-3H3 |
| InChIKey | JCLMAOUDJSGMSA-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.27 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|