C11H21N3 — CID 63968362
1-(1-ethylimidazol-2-yl)-N,2-dimethylbutan-1-amine (PubChem CID 63968362) has the molecular formula C11H21N3 and a molecular weight of 195.31 g/mol. Its IUPAC name is 1-(1-ethylimidazol-2-yl)-N,2-dimethylbutan-1-amine.
| Compound Name | 1-(1-ethylimidazol-2-yl)-N,2-dimethylbutan-1-amine |
|---|---|
| PubChem CID | 63968362 |
| Molecular Formula | C11H21N3 |
| Molecular Weight | 195.31 g/mol |
| Exact Mass | 195.17 |
| IUPAC Name | 1-(1-ethylimidazol-2-yl)-N,2-dimethylbutan-1-amine |
| SMILES | CCC(C)C(NC)c1nccn1CC |
| InChI | InChI=1S/C11H21N3/c1-5-9(3)10(12-4)11-13-7-8-14(11)6-2/h7-10,12H,5-6H2,1-4H3 |
| InChIKey | NUOPLVSTPPUSAS-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.31 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |