C12H11F5N4 — CID 105308467
[(1-ethylimidazol-2-yl)-(2,3,4,5,6-pentafluorophenyl)methyl]hydrazine (PubChem CID 105308467) has the molecular formula C12H11F5N4 and a molecular weight of 306.24 g/mol. Its IUPAC name is [(1-ethylimidazol-2-yl)-(2,3,4,5,6-pentafluorophenyl)methyl]hydrazine.
| Compound Name | [(1-ethylimidazol-2-yl)-(2,3,4,5,6-pentafluorophenyl)methyl]hydrazine |
|---|---|
| PubChem CID | 105308467 |
| Molecular Formula | C12H11F5N4 |
| Molecular Weight | 306.24 g/mol |
| Exact Mass | 306.09 |
| IUPAC Name | [(1-ethylimidazol-2-yl)-(2,3,4,5,6-pentafluorophenyl)methyl]hydrazine |
| SMILES | CCn1ccnc1C(NN)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C12H11F5N4/c1-2-21-4-3-19-12(21)11(20-18)5-6(13)8(15)10(17)9(16)7(5)14/h3-4,11,20H,2,18H2,1H3 |
| InChIKey | FZRFPRFQBYQOPG-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 55.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.24 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|