C17H28Cl2N2 — CID 105309812
1-(2,5-dichlorophenyl)undecan-2-ylhydrazine (PubChem CID 105309812) has the molecular formula C17H28Cl2N2 and a molecular weight of 331.33 g/mol. Its IUPAC name is 1-(2,5-dichlorophenyl)undecan-2-ylhydrazine.
| Compound Name | 1-(2,5-dichlorophenyl)undecan-2-ylhydrazine |
|---|---|
| PubChem CID | 105309812 |
| Molecular Formula | C17H28Cl2N2 |
| Molecular Weight | 331.33 g/mol |
| Exact Mass | 330.16 |
| IUPAC Name | 1-(2,5-dichlorophenyl)undecan-2-ylhydrazine |
| SMILES | CCCCCCCCCC(Cc1cc(Cl)ccc1Cl)NN |
| InChI | InChI=1S/C17H28Cl2N2/c1-2-3-4-5-6-7-8-9-16(21-20)13-14-12-15(18)10-11-17(14)19/h10-12,16,21H,2-9,13,20H2,1H3 |
| InChIKey | RMHRXLVENJYUMF-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.33 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|