C16H17IN2S — CID 105310289
[1-(2,3-dihydro-1-benzothiophen-2-yl)-2-(4-iodophenyl)ethyl]hydrazine (PubChem CID 105310289) has the molecular formula C16H17IN2S and a molecular weight of 396.30 g/mol. Its IUPAC name is [1-(2,3-dihydro-1-benzothiophen-2-yl)-2-(4-iodophenyl)ethyl]hydrazine.
| Compound Name | [1-(2,3-dihydro-1-benzothiophen-2-yl)-2-(4-iodophenyl)ethyl]hydrazine |
|---|---|
| PubChem CID | 105310289 |
| Molecular Formula | C16H17IN2S |
| Molecular Weight | 396.30 g/mol |
| Exact Mass | 396.02 |
| IUPAC Name | [1-(2,3-dihydro-1-benzothiophen-2-yl)-2-(4-iodophenyl)ethyl]hydrazine |
| SMILES | NNC(Cc1ccc(I)cc1)C1Cc2ccccc2S1 |
| InChI | InChI=1S/C16H17IN2S/c17-13-7-5-11(6-8-13)9-14(19-18)16-10-12-3-1-2-4-15(12)20-16/h1-8,14,16,19H,9-10,18H2 |
| InChIKey | AYOQNDMLAFGWSU-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.30 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|