C14H18N2S — CID 105334973
1-(2,3-dihydro-1-benzothiophen-2-yl)hex-4-ynylhydrazine (PubChem CID 105334973) has the molecular formula C14H18N2S and a molecular weight of 246.38 g/mol. Its IUPAC name is 1-(2,3-dihydro-1-benzothiophen-2-yl)hex-4-ynylhydrazine.
| Compound Name | 1-(2,3-dihydro-1-benzothiophen-2-yl)hex-4-ynylhydrazine |
|---|---|
| PubChem CID | 105334973 |
| Molecular Formula | C14H18N2S |
| Molecular Weight | 246.38 g/mol |
| Exact Mass | 246.12 |
| IUPAC Name | 1-(2,3-dihydro-1-benzothiophen-2-yl)hex-4-ynylhydrazine |
| SMILES | CC#CCCC(NN)C1Cc2ccccc2S1 |
| InChI | InChI=1S/C14H18N2S/c1-2-3-4-8-12(16-15)14-10-11-7-5-6-9-13(11)17-14/h5-7,9,12,14,16H,4,8,10,15H2,1H3 |
| InChIKey | NGMRRAFZSRZHRK-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.38 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|