C16H23IN4 — CID 105310364
[1-(4-iodophenyl)-4-(1,3,5-trimethylpyrazol-4-yl)butan-2-yl]hydrazine (PubChem CID 105310364) has the molecular formula C16H23IN4 and a molecular weight of 398.29 g/mol. Its IUPAC name is [1-(4-iodophenyl)-4-(1,3,5-trimethylpyrazol-4-yl)butan-2-yl]hydrazine.
| Compound Name | [1-(4-iodophenyl)-4-(1,3,5-trimethylpyrazol-4-yl)butan-2-yl]hydrazine |
|---|---|
| PubChem CID | 105310364 |
| Molecular Formula | C16H23IN4 |
| Molecular Weight | 398.29 g/mol |
| Exact Mass | 398.10 |
| IUPAC Name | [1-(4-iodophenyl)-4-(1,3,5-trimethylpyrazol-4-yl)butan-2-yl]hydrazine |
| SMILES | Cc1nn(C)c(C)c1CCC(Cc1ccc(I)cc1)NN |
| InChI | InChI=1S/C16H23IN4/c1-11-16(12(2)21(3)20-11)9-8-15(19-18)10-13-4-6-14(17)7-5-13/h4-7,15,19H,8-10,18H2,1-3H3 |
| InChIKey | SPYBMRGXXGPFIS-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 55.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.29 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|