C13H19ClN4S — CID 105312536
[2-(1-butan-2-ylpyrazol-3-yl)-1-(3-chlorothiophen-2-yl)ethyl]hydrazine (PubChem CID 105312536) has the molecular formula C13H19ClN4S and a molecular weight of 298.84 g/mol. Its IUPAC name is [2-(1-butan-2-ylpyrazol-3-yl)-1-(3-chlorothiophen-2-yl)ethyl]hydrazine.
| Compound Name | [2-(1-butan-2-ylpyrazol-3-yl)-1-(3-chlorothiophen-2-yl)ethyl]hydrazine |
|---|---|
| PubChem CID | 105312536 |
| Molecular Formula | C13H19ClN4S |
| Molecular Weight | 298.84 g/mol |
| Exact Mass | 298.10 |
| IUPAC Name | [2-(1-butan-2-ylpyrazol-3-yl)-1-(3-chlorothiophen-2-yl)ethyl]hydrazine |
| SMILES | CCC(C)n1ccc(CC(NN)c2sccc2Cl)n1 |
| InChI | InChI=1S/C13H19ClN4S/c1-3-9(2)18-6-4-10(17-18)8-12(16-15)13-11(14)5-7-19-13/h4-7,9,12,16H,3,8,15H2,1-2H3 |
| InChIKey | UPVLMQBQYLDTMW-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 55.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.84 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|