C16H26N4S — CID 105313402
[1-(3-ethylthiophen-2-yl)-2-(1-pentan-3-ylpyrazol-3-yl)ethyl]hydrazine (PubChem CID 105313402) has the molecular formula C16H26N4S and a molecular weight of 306.48 g/mol. Its IUPAC name is [1-(3-ethylthiophen-2-yl)-2-(1-pentan-3-ylpyrazol-3-yl)ethyl]hydrazine.
| Compound Name | [1-(3-ethylthiophen-2-yl)-2-(1-pentan-3-ylpyrazol-3-yl)ethyl]hydrazine |
|---|---|
| PubChem CID | 105313402 |
| Molecular Formula | C16H26N4S |
| Molecular Weight | 306.48 g/mol |
| Exact Mass | 306.19 |
| IUPAC Name | [1-(3-ethylthiophen-2-yl)-2-(1-pentan-3-ylpyrazol-3-yl)ethyl]hydrazine |
| SMILES | CCc1ccsc1C(Cc1ccn(C(CC)CC)n1)NN |
| InChI | InChI=1S/C16H26N4S/c1-4-12-8-10-21-16(12)15(18-17)11-13-7-9-20(19-13)14(5-2)6-3/h7-10,14-15,18H,4-6,11,17H2,1-3H3 |
| InChIKey | ATCSGKBTOULDFN-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 55.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.48 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|