C14H24N6 — CID 105228507
[1-(1-methylpyrazol-4-yl)-2-(1-pentan-3-ylpyrazol-3-yl)ethyl]hydrazine (PubChem CID 105228507) has the molecular formula C14H24N6 and a molecular weight of 276.39 g/mol. Its IUPAC name is [1-(1-methylpyrazol-4-yl)-2-(1-pentan-3-ylpyrazol-3-yl)ethyl]hydrazine.
| Compound Name | [1-(1-methylpyrazol-4-yl)-2-(1-pentan-3-ylpyrazol-3-yl)ethyl]hydrazine |
|---|---|
| PubChem CID | 105228507 |
| Molecular Formula | C14H24N6 |
| Molecular Weight | 276.39 g/mol |
| Exact Mass | 276.21 |
| IUPAC Name | [1-(1-methylpyrazol-4-yl)-2-(1-pentan-3-ylpyrazol-3-yl)ethyl]hydrazine |
| SMILES | CCC(CC)n1ccc(CC(NN)c2cnn(C)c2)n1 |
| InChI | InChI=1S/C14H24N6/c1-4-13(5-2)20-7-6-12(18-20)8-14(17-15)11-9-16-19(3)10-11/h6-7,9-10,13-14,17H,4-5,8,15H2,1-3H3 |
| InChIKey | HUENDFQNJNUHDM-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 73.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.39 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|