C12H16N2S2 — CID 105313192
[(3-ethylthiophen-2-yl)-(5-methylthiophen-3-yl)methyl]hydrazine (PubChem CID 105313192) has the molecular formula C12H16N2S2 and a molecular weight of 252.41 g/mol. Its IUPAC name is [(3-ethylthiophen-2-yl)-(5-methylthiophen-3-yl)methyl]hydrazine.
| Compound Name | [(3-ethylthiophen-2-yl)-(5-methylthiophen-3-yl)methyl]hydrazine |
|---|---|
| PubChem CID | 105313192 |
| Molecular Formula | C12H16N2S2 |
| Molecular Weight | 252.41 g/mol |
| Exact Mass | 252.08 |
| IUPAC Name | [(3-ethylthiophen-2-yl)-(5-methylthiophen-3-yl)methyl]hydrazine |
| SMILES | CCc1ccsc1C(NN)c1csc(C)c1 |
| InChI | InChI=1S/C12H16N2S2/c1-3-9-4-5-15-12(9)11(14-13)10-6-8(2)16-7-10/h4-7,11,14H,3,13H2,1-2H3 |
| InChIKey | HTEDJEBIDRYSLO-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.41 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|