C16H22N2OS — CID 105332940
[(3-ethylthiophen-2-yl)-(4-methoxy-2,5-dimethylphenyl)methyl]hydrazine (PubChem CID 105332940) has the molecular formula C16H22N2OS and a molecular weight of 290.43 g/mol. Its IUPAC name is [(3-ethylthiophen-2-yl)-(4-methoxy-2,5-dimethylphenyl)methyl]hydrazine.
| Compound Name | [(3-ethylthiophen-2-yl)-(4-methoxy-2,5-dimethylphenyl)methyl]hydrazine |
|---|---|
| PubChem CID | 105332940 |
| Molecular Formula | C16H22N2OS |
| Molecular Weight | 290.43 g/mol |
| Exact Mass | 290.15 |
| IUPAC Name | [(3-ethylthiophen-2-yl)-(4-methoxy-2,5-dimethylphenyl)methyl]hydrazine |
| SMILES | CCc1ccsc1C(NN)c1cc(C)c(OC)cc1C |
| InChI | InChI=1S/C16H22N2OS/c1-5-12-6-7-20-16(12)15(18-17)13-8-11(3)14(19-4)9-10(13)2/h6-9,15,18H,5,17H2,1-4H3 |
| InChIKey | JSNMJZMHAWYGMY-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.43 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|