C9H17F3N2O — CID 105313969
[4,4,4-trifluoro-1-(5-methyloxolan-2-yl)butyl]hydrazine (PubChem CID 105313969) has the molecular formula C9H17F3N2O and a molecular weight of 226.24 g/mol. Its IUPAC name is [4,4,4-trifluoro-1-(5-methyloxolan-2-yl)butyl]hydrazine.
| Compound Name | [4,4,4-trifluoro-1-(5-methyloxolan-2-yl)butyl]hydrazine |
|---|---|
| PubChem CID | 105313969 |
| Molecular Formula | C9H17F3N2O |
| Molecular Weight | 226.24 g/mol |
| Exact Mass | 226.13 |
| IUPAC Name | [4,4,4-trifluoro-1-(5-methyloxolan-2-yl)butyl]hydrazine |
| SMILES | CC1CCC(C(CCC(F)(F)F)NN)O1 |
| InChI | InChI=1S/C9H17F3N2O/c1-6-2-3-8(15-6)7(14-13)4-5-9(10,11)12/h6-8,14H,2-5,13H2,1H3 |
| InChIKey | LCIPSCZBFWTIPL-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.24 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|