C15H22BrN5 — CID 105314929
[1-(4-bromo-3-ethyl-1-methylpyrazol-5-yl)-4-pyridin-2-ylbutan-2-yl]hydrazine (PubChem CID 105314929) has the molecular formula C15H22BrN5 and a molecular weight of 352.28 g/mol. Its IUPAC name is [1-(4-bromo-3-ethyl-1-methylpyrazol-5-yl)-4-pyridin-2-ylbutan-2-yl]hydrazine.
| Compound Name | [1-(4-bromo-3-ethyl-1-methylpyrazol-5-yl)-4-pyridin-2-ylbutan-2-yl]hydrazine |
|---|---|
| PubChem CID | 105314929 |
| Molecular Formula | C15H22BrN5 |
| Molecular Weight | 352.28 g/mol |
| Exact Mass | 351.11 |
| IUPAC Name | [1-(4-bromo-3-ethyl-1-methylpyrazol-5-yl)-4-pyridin-2-ylbutan-2-yl]hydrazine |
| SMILES | CCc1nn(C)c(CC(CCc2ccccn2)NN)c1Br |
| InChI | InChI=1S/C15H22BrN5/c1-3-13-15(16)14(21(2)20-13)10-12(19-17)8-7-11-6-4-5-9-18-11/h4-6,9,12,19H,3,7-8,10,17H2,1-2H3 |
| InChIKey | PUCHSKLUJZVKPV-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.28 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|