C12H16N2O — CID 105315638
1-(3-propoxyphenyl)prop-2-ynylhydrazine (PubChem CID 105315638) has the molecular formula C12H16N2O and a molecular weight of 204.27 g/mol. Its IUPAC name is 1-(3-propoxyphenyl)prop-2-ynylhydrazine.
| Compound Name | 1-(3-propoxyphenyl)prop-2-ynylhydrazine |
|---|---|
| PubChem CID | 105315638 |
| Molecular Formula | C12H16N2O |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.13 |
| IUPAC Name | 1-(3-propoxyphenyl)prop-2-ynylhydrazine |
| SMILES | C#CC(NN)c1cccc(OCCC)c1 |
| InChI | InChI=1S/C12H16N2O/c1-3-8-15-11-7-5-6-10(9-11)12(4-2)14-13/h2,5-7,9,12,14H,3,8,13H2,1H3 |
| InChIKey | UXTHSEVNNXELSO-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|