C14H20N2O — CID 65380972
1-(3-propoxyphenyl)-N-prop-2-ynylethane-1,2-diamine (PubChem CID 65380972) has the molecular formula C14H20N2O and a molecular weight of 232.33 g/mol. Its IUPAC name is 1-(3-propoxyphenyl)-N-prop-2-ynylethane-1,2-diamine.
| Compound Name | 1-(3-propoxyphenyl)-N-prop-2-ynylethane-1,2-diamine |
|---|---|
| PubChem CID | 65380972 |
| Molecular Formula | C14H20N2O |
| Molecular Weight | 232.33 g/mol |
| Exact Mass | 232.16 |
| IUPAC Name | 1-(3-propoxyphenyl)-N-prop-2-ynylethane-1,2-diamine |
| SMILES | C#CCNC(CN)c1cccc(OCCC)c1 |
| InChI | InChI=1S/C14H20N2O/c1-3-8-16-14(11-15)12-6-5-7-13(10-12)17-9-4-2/h1,5-7,10,14,16H,4,8-9,11,15H2,2H3 |
| InChIKey | AHSRCUVQLFCXOZ-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.33 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|