C13H20F2N2O — CID 115406289
N-(2,2-difluoroethyl)-1-(3-propoxyphenyl)ethane-1,2-diamine (PubChem CID 115406289) has the molecular formula C13H20F2N2O and a molecular weight of 258.31 g/mol. Its IUPAC name is N-(2,2-difluoroethyl)-1-(3-propoxyphenyl)ethane-1,2-diamine.
| Compound Name | N-(2,2-difluoroethyl)-1-(3-propoxyphenyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 115406289 |
| Molecular Formula | C13H20F2N2O |
| Molecular Weight | 258.31 g/mol |
| Exact Mass | 258.15 |
| IUPAC Name | N-(2,2-difluoroethyl)-1-(3-propoxyphenyl)ethane-1,2-diamine |
| SMILES | CCCOc1cccc(C(CN)NCC(F)F)c1 |
| InChI | InChI=1S/C13H20F2N2O/c1-2-6-18-11-5-3-4-10(7-11)12(8-16)17-9-13(14)15/h3-5,7,12-13,17H,2,6,8-9,16H2,1H3 |
| InChIKey | ONHWQKLCCBOPPL-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.31 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |