C24H22Br4 — CID 10532051
4,5,9,10-tetrabromo-2,7-ditert-butylpyrene (PubChem CID 10532051) has the molecular formula C24H22Br4 and a molecular weight of 630.06 g/mol. Its IUPAC name is 4,5,9,10-tetrabromo-2,7-ditert-butylpyrene.
| Compound Name | 4,5,9,10-tetrabromo-2,7-ditert-butylpyrene |
|---|---|
| PubChem CID | 10532051 |
| Molecular Formula | C24H22Br4 |
| Molecular Weight | 630.06 g/mol |
| Exact Mass | 625.85 |
| IUPAC Name | 4,5,9,10-tetrabromo-2,7-ditert-butylpyrene |
| SMILES | CC(C)(C)c1cc2c(Br)c(Br)c3cc(C(C)(C)C)cc4c(Br)c(Br)c(c1)c2c34 |
| InChI | InChI=1S/C24H22Br4/c1-23(2,3)11-7-13-17-14(8-11)20(26)22(28)16-10-12(24(4,5)6)9-15(18(16)17)21(27)19(13)25/h7-10H,1-6H3 |
| InChIKey | KBEKICQYZXSFSA-UHFFFAOYSA-N |
| XLogP | 10.23 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.06 |
| LogP ≤ 5 | 10.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|