C13H20N4S — CID 105322494
[1-(3-methylthiophen-2-yl)-2-(1,3,5-trimethylpyrazol-4-yl)ethyl]hydrazine (PubChem CID 105322494) has the molecular formula C13H20N4S and a molecular weight of 264.40 g/mol. Its IUPAC name is [1-(3-methylthiophen-2-yl)-2-(1,3,5-trimethylpyrazol-4-yl)ethyl]hydrazine.
| Compound Name | [1-(3-methylthiophen-2-yl)-2-(1,3,5-trimethylpyrazol-4-yl)ethyl]hydrazine |
|---|---|
| PubChem CID | 105322494 |
| Molecular Formula | C13H20N4S |
| Molecular Weight | 264.40 g/mol |
| Exact Mass | 264.14 |
| IUPAC Name | [1-(3-methylthiophen-2-yl)-2-(1,3,5-trimethylpyrazol-4-yl)ethyl]hydrazine |
| SMILES | Cc1ccsc1C(Cc1c(C)nn(C)c1C)NN |
| InChI | InChI=1S/C13H20N4S/c1-8-5-6-18-13(8)12(15-14)7-11-9(2)16-17(4)10(11)3/h5-6,12,15H,7,14H2,1-4H3 |
| InChIKey | PMJKKSNALMJLSN-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 55.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.40 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|