C12H18N4S — CID 105322374
[(3-methylthiophen-2-yl)-(1,3,5-trimethylpyrazol-4-yl)methyl]hydrazine (PubChem CID 105322374) has the molecular formula C12H18N4S and a molecular weight of 250.37 g/mol. Its IUPAC name is [(3-methylthiophen-2-yl)-(1,3,5-trimethylpyrazol-4-yl)methyl]hydrazine.
| Compound Name | [(3-methylthiophen-2-yl)-(1,3,5-trimethylpyrazol-4-yl)methyl]hydrazine |
|---|---|
| PubChem CID | 105322374 |
| Molecular Formula | C12H18N4S |
| Molecular Weight | 250.37 g/mol |
| Exact Mass | 250.13 |
| IUPAC Name | [(3-methylthiophen-2-yl)-(1,3,5-trimethylpyrazol-4-yl)methyl]hydrazine |
| SMILES | Cc1ccsc1C(NN)c1c(C)nn(C)c1C |
| InChI | InChI=1S/C12H18N4S/c1-7-5-6-17-12(7)11(14-13)10-8(2)15-16(4)9(10)3/h5-6,11,14H,13H2,1-4H3 |
| InChIKey | DCJCNHMVRYKBOX-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 55.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.37 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|