C16H24N4O — CID 103436361
[(2-methoxy-3,4-dimethylphenyl)-(1,3,5-trimethylpyrazol-4-yl)methyl]hydrazine (PubChem CID 103436361) has the molecular formula C16H24N4O and a molecular weight of 288.39 g/mol. Its IUPAC name is [(2-methoxy-3,4-dimethylphenyl)-(1,3,5-trimethylpyrazol-4-yl)methyl]hydrazine.
| Compound Name | [(2-methoxy-3,4-dimethylphenyl)-(1,3,5-trimethylpyrazol-4-yl)methyl]hydrazine |
|---|---|
| PubChem CID | 103436361 |
| Molecular Formula | C16H24N4O |
| Molecular Weight | 288.39 g/mol |
| Exact Mass | 288.20 |
| IUPAC Name | [(2-methoxy-3,4-dimethylphenyl)-(1,3,5-trimethylpyrazol-4-yl)methyl]hydrazine |
| SMILES | COc1c(C(NN)c2c(C)nn(C)c2C)ccc(C)c1C |
| InChI | InChI=1S/C16H24N4O/c1-9-7-8-13(16(21-6)10(9)2)15(18-17)14-11(3)19-20(5)12(14)4/h7-8,15,18H,17H2,1-6H3 |
| InChIKey | XYBDYVGNERHDFN-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 65.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.39 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|