C15H22N4 — CID 105286716
[(3,5-dimethylphenyl)-(1,3,5-trimethylpyrazol-4-yl)methyl]hydrazine (PubChem CID 105286716) has the molecular formula C15H22N4 and a molecular weight of 258.37 g/mol. Its IUPAC name is [(3,5-dimethylphenyl)-(1,3,5-trimethylpyrazol-4-yl)methyl]hydrazine.
| Compound Name | [(3,5-dimethylphenyl)-(1,3,5-trimethylpyrazol-4-yl)methyl]hydrazine |
|---|---|
| PubChem CID | 105286716 |
| Molecular Formula | C15H22N4 |
| Molecular Weight | 258.37 g/mol |
| Exact Mass | 258.18 |
| IUPAC Name | [(3,5-dimethylphenyl)-(1,3,5-trimethylpyrazol-4-yl)methyl]hydrazine |
| SMILES | Cc1cc(C)cc(C(NN)c2c(C)nn(C)c2C)c1 |
| InChI | InChI=1S/C15H22N4/c1-9-6-10(2)8-13(7-9)15(17-16)14-11(3)18-19(5)12(14)4/h6-8,15,17H,16H2,1-5H3 |
| InChIKey | CJZYXQHKFWTIJT-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 55.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.37 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|