C12H17N5 — CID 105287039
[pyridin-3-yl-(1,3,5-trimethylpyrazol-4-yl)methyl]hydrazine (PubChem CID 105287039) has the molecular formula C12H17N5 and a molecular weight of 231.30 g/mol. Its IUPAC name is [pyridin-3-yl-(1,3,5-trimethylpyrazol-4-yl)methyl]hydrazine.
| Compound Name | [pyridin-3-yl-(1,3,5-trimethylpyrazol-4-yl)methyl]hydrazine |
|---|---|
| PubChem CID | 105287039 |
| Molecular Formula | C12H17N5 |
| Molecular Weight | 231.30 g/mol |
| Exact Mass | 231.15 |
| IUPAC Name | [pyridin-3-yl-(1,3,5-trimethylpyrazol-4-yl)methyl]hydrazine |
| SMILES | Cc1nn(C)c(C)c1C(NN)c1cccnc1 |
| InChI | InChI=1S/C12H17N5/c1-8-11(9(2)17(3)16-8)12(15-13)10-5-4-6-14-7-10/h4-7,12,15H,13H2,1-3H3 |
| InChIKey | VTUAKWCHDBFPMK-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.30 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|