C17H26N4 — CID 105300373
[(4-tert-butylphenyl)-(1,3,5-trimethylpyrazol-4-yl)methyl]hydrazine (PubChem CID 105300373) has the molecular formula C17H26N4 and a molecular weight of 286.42 g/mol. Its IUPAC name is [(4-tert-butylphenyl)-(1,3,5-trimethylpyrazol-4-yl)methyl]hydrazine.
| Compound Name | [(4-tert-butylphenyl)-(1,3,5-trimethylpyrazol-4-yl)methyl]hydrazine |
|---|---|
| PubChem CID | 105300373 |
| Molecular Formula | C17H26N4 |
| Molecular Weight | 286.42 g/mol |
| Exact Mass | 286.22 |
| IUPAC Name | [(4-tert-butylphenyl)-(1,3,5-trimethylpyrazol-4-yl)methyl]hydrazine |
| SMILES | Cc1nn(C)c(C)c1C(NN)c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C17H26N4/c1-11-15(12(2)21(6)20-11)16(19-18)13-7-9-14(10-8-13)17(3,4)5/h7-10,16,19H,18H2,1-6H3 |
| InChIKey | FRCZPFBXYIKDJJ-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 55.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.42 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|