C13H15F3N4 — CID 114220219
[(1,5-dimethylpyrazol-3-yl)-[4-(trifluoromethyl)phenyl]methyl]hydrazine (PubChem CID 114220219) has the molecular formula C13H15F3N4 and a molecular weight of 284.29 g/mol. Its IUPAC name is [(1,5-dimethylpyrazol-3-yl)-[4-(trifluoromethyl)phenyl]methyl]hydrazine.
| Compound Name | [(1,5-dimethylpyrazol-3-yl)-[4-(trifluoromethyl)phenyl]methyl]hydrazine |
|---|---|
| PubChem CID | 114220219 |
| Molecular Formula | C13H15F3N4 |
| Molecular Weight | 284.29 g/mol |
| Exact Mass | 284.12 |
| IUPAC Name | [(1,5-dimethylpyrazol-3-yl)-[4-(trifluoromethyl)phenyl]methyl]hydrazine |
| SMILES | Cc1cc(C(NN)c2ccc(C(F)(F)F)cc2)nn1C |
| InChI | InChI=1S/C13H15F3N4/c1-8-7-11(19-20(8)2)12(18-17)9-3-5-10(6-4-9)13(14,15)16/h3-7,12,18H,17H2,1-2H3 |
| InChIKey | IFXGTTLFIIFYKS-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 55.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.29 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|