C13H16F2N4 — CID 105304935
[(3,4-difluorophenyl)-(1,3,5-trimethylpyrazol-4-yl)methyl]hydrazine (PubChem CID 105304935) has the molecular formula C13H16F2N4 and a molecular weight of 266.30 g/mol. Its IUPAC name is [(3,4-difluorophenyl)-(1,3,5-trimethylpyrazol-4-yl)methyl]hydrazine.
| Compound Name | [(3,4-difluorophenyl)-(1,3,5-trimethylpyrazol-4-yl)methyl]hydrazine |
|---|---|
| PubChem CID | 105304935 |
| Molecular Formula | C13H16F2N4 |
| Molecular Weight | 266.30 g/mol |
| Exact Mass | 266.13 |
| IUPAC Name | [(3,4-difluorophenyl)-(1,3,5-trimethylpyrazol-4-yl)methyl]hydrazine |
| SMILES | Cc1nn(C)c(C)c1C(NN)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C13H16F2N4/c1-7-12(8(2)19(3)18-7)13(17-16)9-4-5-10(14)11(15)6-9/h4-6,13,17H,16H2,1-3H3 |
| InChIKey | VYKBXMDRBCXGSQ-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 55.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.30 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|