C13H13F2N3 — CID 106756542
[(3,4-difluorophenyl)-(2-methyl-4-pyridinyl)methyl]hydrazine (PubChem CID 106756542) has the molecular formula C13H13F2N3 and a molecular weight of 249.26 g/mol. Its IUPAC name is [(3,4-difluorophenyl)-(2-methyl-4-pyridinyl)methyl]hydrazine.
| Compound Name | [(3,4-difluorophenyl)-(2-methyl-4-pyridinyl)methyl]hydrazine |
|---|---|
| PubChem CID | 106756542 |
| Molecular Formula | C13H13F2N3 |
| Molecular Weight | 249.26 g/mol |
| Exact Mass | 249.11 |
| IUPAC Name | [(3,4-difluorophenyl)-(2-methyl-4-pyridinyl)methyl]hydrazine |
| SMILES | Cc1cc(C(NN)c2ccc(F)c(F)c2)ccn1 |
| InChI | InChI=1S/C13H13F2N3/c1-8-6-10(4-5-17-8)13(18-16)9-2-3-11(14)12(15)7-9/h2-7,13,18H,16H2,1H3 |
| InChIKey | AEPPIJBGFRVTEZ-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.26 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|