C13H12BrF2N3 — CID 106945509
[(3-bromo-2,6-difluorophenyl)-(2-methyl-4-pyridinyl)methyl]hydrazine (PubChem CID 106945509) has the molecular formula C13H12BrF2N3 and a molecular weight of 328.16 g/mol. Its IUPAC name is [(3-bromo-2,6-difluorophenyl)-(2-methyl-4-pyridinyl)methyl]hydrazine.
| Compound Name | [(3-bromo-2,6-difluorophenyl)-(2-methyl-4-pyridinyl)methyl]hydrazine |
|---|---|
| PubChem CID | 106945509 |
| Molecular Formula | C13H12BrF2N3 |
| Molecular Weight | 328.16 g/mol |
| Exact Mass | 327.02 |
| IUPAC Name | [(3-bromo-2,6-difluorophenyl)-(2-methyl-4-pyridinyl)methyl]hydrazine |
| SMILES | Cc1cc(C(NN)c2c(F)ccc(Br)c2F)ccn1 |
| InChI | InChI=1S/C13H12BrF2N3/c1-7-6-8(4-5-18-7)13(19-17)11-10(15)3-2-9(14)12(11)16/h2-6,13,19H,17H2,1H3 |
| InChIKey | ZEQXAFGJNHJJHB-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.16 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|