C11H9BrF2N4 — CID 106945260
[(3-bromo-2,6-difluorophenyl)-pyrazin-2-ylmethyl]hydrazine (PubChem CID 106945260) has the molecular formula C11H9BrF2N4 and a molecular weight of 315.12 g/mol. Its IUPAC name is [(3-bromo-2,6-difluorophenyl)-pyrazin-2-ylmethyl]hydrazine.
| Compound Name | [(3-bromo-2,6-difluorophenyl)-pyrazin-2-ylmethyl]hydrazine |
|---|---|
| PubChem CID | 106945260 |
| Molecular Formula | C11H9BrF2N4 |
| Molecular Weight | 315.12 g/mol |
| Exact Mass | 314.00 |
| IUPAC Name | [(3-bromo-2,6-difluorophenyl)-pyrazin-2-ylmethyl]hydrazine |
| SMILES | NNC(c1cnccn1)c1c(F)ccc(Br)c1F |
| InChI | InChI=1S/C11H9BrF2N4/c12-6-1-2-7(13)9(10(6)14)11(18-15)8-5-16-3-4-17-8/h1-5,11,18H,15H2 |
| InChIKey | XULWRBMOMISTLP-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.12 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|