C16H26N2OS — CID 105325420
[(4,5-dimethylthiophen-2-yl)-(6-oxaspiro[4.5]decan-9-yl)methyl]hydrazine (PubChem CID 105325420) has the molecular formula C16H26N2OS and a molecular weight of 294.46 g/mol. Its IUPAC name is [(4,5-dimethylthiophen-2-yl)-(6-oxaspiro[4.5]decan-9-yl)methyl]hydrazine.
| Compound Name | [(4,5-dimethylthiophen-2-yl)-(6-oxaspiro[4.5]decan-9-yl)methyl]hydrazine |
|---|---|
| PubChem CID | 105325420 |
| Molecular Formula | C16H26N2OS |
| Molecular Weight | 294.46 g/mol |
| Exact Mass | 294.18 |
| IUPAC Name | [(4,5-dimethylthiophen-2-yl)-(6-oxaspiro[4.5]decan-9-yl)methyl]hydrazine |
| SMILES | Cc1cc(C(NN)C2CCOC3(CCCC3)C2)sc1C |
| InChI | InChI=1S/C16H26N2OS/c1-11-9-14(20-12(11)2)15(18-17)13-5-8-19-16(10-13)6-3-4-7-16/h9,13,15,18H,3-8,10,17H2,1-2H3 |
| InChIKey | OXFRDDYAHFFYKT-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.46 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|