C15H27N3 — CID 105328512
[3,5,5-trimethyl-1-(5-methyl-3-pyridinyl)hexyl]hydrazine (PubChem CID 105328512) has the molecular formula C15H27N3 and a molecular weight of 249.40 g/mol. Its IUPAC name is [3,5,5-trimethyl-1-(5-methyl-3-pyridinyl)hexyl]hydrazine.
| Compound Name | [3,5,5-trimethyl-1-(5-methyl-3-pyridinyl)hexyl]hydrazine |
|---|---|
| PubChem CID | 105328512 |
| Molecular Formula | C15H27N3 |
| Molecular Weight | 249.40 g/mol |
| Exact Mass | 249.22 |
| IUPAC Name | [3,5,5-trimethyl-1-(5-methyl-3-pyridinyl)hexyl]hydrazine |
| SMILES | Cc1cncc(C(CC(C)CC(C)(C)C)NN)c1 |
| InChI | InChI=1S/C15H27N3/c1-11(8-15(3,4)5)7-14(18-16)13-6-12(2)9-17-10-13/h6,9-11,14,18H,7-8,16H2,1-5H3 |
| InChIKey | FRYIDJJVQDYNDT-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.40 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|