C14H25N3 — CID 105328653
[3,4,4-trimethyl-1-(5-methyl-3-pyridinyl)pentyl]hydrazine (PubChem CID 105328653) has the molecular formula C14H25N3 and a molecular weight of 235.37 g/mol. Its IUPAC name is [3,4,4-trimethyl-1-(5-methyl-3-pyridinyl)pentyl]hydrazine.
| Compound Name | [3,4,4-trimethyl-1-(5-methyl-3-pyridinyl)pentyl]hydrazine |
|---|---|
| PubChem CID | 105328653 |
| Molecular Formula | C14H25N3 |
| Molecular Weight | 235.37 g/mol |
| Exact Mass | 235.20 |
| IUPAC Name | [3,4,4-trimethyl-1-(5-methyl-3-pyridinyl)pentyl]hydrazine |
| SMILES | Cc1cncc(C(CC(C)C(C)(C)C)NN)c1 |
| InChI | InChI=1S/C14H25N3/c1-10-6-12(9-16-8-10)13(17-15)7-11(2)14(3,4)5/h6,8-9,11,13,17H,7,15H2,1-5H3 |
| InChIKey | XMGXQTYUJQXVIK-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.37 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|