C8H17F3N2O2S — CID 105328967
(7,7,7-trifluoro-2-methylsulfonylheptan-3-yl)hydrazine (PubChem CID 105328967) has the molecular formula C8H17F3N2O2S and a molecular weight of 262.30 g/mol. Its IUPAC name is (7,7,7-trifluoro-2-methylsulfonylheptan-3-yl)hydrazine.
| Compound Name | (7,7,7-trifluoro-2-methylsulfonylheptan-3-yl)hydrazine |
|---|---|
| PubChem CID | 105328967 |
| Molecular Formula | C8H17F3N2O2S |
| Molecular Weight | 262.30 g/mol |
| Exact Mass | 262.10 |
| IUPAC Name | (7,7,7-trifluoro-2-methylsulfonylheptan-3-yl)hydrazine |
| SMILES | CC(C(CCCC(F)(F)F)NN)S(C)(=O)=O |
| InChI | InChI=1S/C8H17F3N2O2S/c1-6(16(2,14)15)7(13-12)4-3-5-8(9,10)11/h6-7,13H,3-5,12H2,1-2H3 |
| InChIKey | SPTMTDGSPUJBMF-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.30 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|