C10H20F3NO2S — CID 104992670
6,6,6-trifluoro-2-methylsulfonyl-N-propylhexan-3-amine (PubChem CID 104992670) has the molecular formula C10H20F3NO2S and a molecular weight of 275.34 g/mol. Its IUPAC name is 6,6,6-trifluoro-2-methylsulfonyl-N-propylhexan-3-amine.
| Compound Name | 6,6,6-trifluoro-2-methylsulfonyl-N-propylhexan-3-amine |
|---|---|
| PubChem CID | 104992670 |
| Molecular Formula | C10H20F3NO2S |
| Molecular Weight | 275.34 g/mol |
| Exact Mass | 275.12 |
| IUPAC Name | 6,6,6-trifluoro-2-methylsulfonyl-N-propylhexan-3-amine |
| SMILES | CCCNC(CCC(F)(F)F)C(C)S(C)(=O)=O |
| InChI | InChI=1S/C10H20F3NO2S/c1-4-7-14-9(5-6-10(11,12)13)8(2)17(3,15)16/h8-9,14H,4-7H2,1-3H3 |
| InChIKey | XXEPVNIZALEBMW-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.34 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |