C12H22F3N — CID 104992954
2-cyclopropyl-6,6,6-trifluoro-N-propylhexan-3-amine (PubChem CID 104992954) has the molecular formula C12H22F3N and a molecular weight of 237.31 g/mol. Its IUPAC name is 2-cyclopropyl-6,6,6-trifluoro-N-propylhexan-3-amine.
| Compound Name | 2-cyclopropyl-6,6,6-trifluoro-N-propylhexan-3-amine |
|---|---|
| PubChem CID | 104992954 |
| Molecular Formula | C12H22F3N |
| Molecular Weight | 237.31 g/mol |
| Exact Mass | 237.17 |
| IUPAC Name | 2-cyclopropyl-6,6,6-trifluoro-N-propylhexan-3-amine |
| SMILES | CCCNC(CCC(F)(F)F)C(C)C1CC1 |
| InChI | InChI=1S/C12H22F3N/c1-3-8-16-11(6-7-12(13,14)15)9(2)10-4-5-10/h9-11,16H,3-8H2,1-2H3 |
| InChIKey | VTJREEIQJPWKBB-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.31 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |