C11H20N2OS — CID 105333259
[3,4-dihydro-2H-pyran-5-yl-(2-methylthiolan-2-yl)methyl]hydrazine (PubChem CID 105333259) has the molecular formula C11H20N2OS and a molecular weight of 228.36 g/mol. Its IUPAC name is [3,4-dihydro-2H-pyran-5-yl-(2-methylthiolan-2-yl)methyl]hydrazine.
| Compound Name | [3,4-dihydro-2H-pyran-5-yl-(2-methylthiolan-2-yl)methyl]hydrazine |
|---|---|
| PubChem CID | 105333259 |
| Molecular Formula | C11H20N2OS |
| Molecular Weight | 228.36 g/mol |
| Exact Mass | 228.13 |
| IUPAC Name | [3,4-dihydro-2H-pyran-5-yl-(2-methylthiolan-2-yl)methyl]hydrazine |
| SMILES | CC1(C(NN)C2=COCCC2)CCCS1 |
| InChI | InChI=1S/C11H20N2OS/c1-11(5-3-7-15-11)10(13-12)9-4-2-6-14-8-9/h8,10,13H,2-7,12H2,1H3 |
| InChIKey | TYDGCBPZLJEVCP-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.36 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|