C11H16N2OS — CID 105251691
[3,4-dihydro-2H-pyran-5-yl-(4-methylthiophen-3-yl)methyl]hydrazine (PubChem CID 105251691) has the molecular formula C11H16N2OS and a molecular weight of 224.33 g/mol. Its IUPAC name is [3,4-dihydro-2H-pyran-5-yl-(4-methylthiophen-3-yl)methyl]hydrazine.
| Compound Name | [3,4-dihydro-2H-pyran-5-yl-(4-methylthiophen-3-yl)methyl]hydrazine |
|---|---|
| PubChem CID | 105251691 |
| Molecular Formula | C11H16N2OS |
| Molecular Weight | 224.33 g/mol |
| Exact Mass | 224.10 |
| IUPAC Name | [3,4-dihydro-2H-pyran-5-yl-(4-methylthiophen-3-yl)methyl]hydrazine |
| SMILES | Cc1cscc1C(NN)C1=COCCC1 |
| InChI | InChI=1S/C11H16N2OS/c1-8-6-15-7-10(8)11(13-12)9-3-2-4-14-5-9/h5-7,11,13H,2-4,12H2,1H3 |
| InChIKey | VXYWAIRNZMNIHX-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.33 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|