C12H15IN2O — CID 105333272
[3,4-dihydro-2H-pyran-5-yl-(4-iodophenyl)methyl]hydrazine (PubChem CID 105333272) has the molecular formula C12H15IN2O and a molecular weight of 330.17 g/mol. Its IUPAC name is [3,4-dihydro-2H-pyran-5-yl-(4-iodophenyl)methyl]hydrazine.
| Compound Name | [3,4-dihydro-2H-pyran-5-yl-(4-iodophenyl)methyl]hydrazine |
|---|---|
| PubChem CID | 105333272 |
| Molecular Formula | C12H15IN2O |
| Molecular Weight | 330.17 g/mol |
| Exact Mass | 330.02 |
| IUPAC Name | [3,4-dihydro-2H-pyran-5-yl-(4-iodophenyl)methyl]hydrazine |
| SMILES | NNC(C1=COCCC1)c1ccc(I)cc1 |
| InChI | InChI=1S/C12H15IN2O/c13-11-5-3-9(4-6-11)12(15-14)10-2-1-7-16-8-10/h3-6,8,12,15H,1-2,7,14H2 |
| InChIKey | DEHFSFPJMIMFFQ-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.17 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|