C12H14BrClN2O — CID 107948477
[(3-bromo-5-chlorophenyl)-(3,4-dihydro-2H-pyran-5-yl)methyl]hydrazine (PubChem CID 107948477) has the molecular formula C12H14BrClN2O and a molecular weight of 317.61 g/mol. Its IUPAC name is [(3-bromo-5-chlorophenyl)-(3,4-dihydro-2H-pyran-5-yl)methyl]hydrazine.
| Compound Name | [(3-bromo-5-chlorophenyl)-(3,4-dihydro-2H-pyran-5-yl)methyl]hydrazine |
|---|---|
| PubChem CID | 107948477 |
| Molecular Formula | C12H14BrClN2O |
| Molecular Weight | 317.61 g/mol |
| Exact Mass | 316.00 |
| IUPAC Name | [(3-bromo-5-chlorophenyl)-(3,4-dihydro-2H-pyran-5-yl)methyl]hydrazine |
| SMILES | NNC(C1=COCCC1)c1cc(Cl)cc(Br)c1 |
| InChI | InChI=1S/C12H14BrClN2O/c13-10-4-9(5-11(14)6-10)12(16-15)8-2-1-3-17-7-8/h4-7,12,16H,1-3,15H2 |
| InChIKey | GFCFCVLOESWJBR-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.61 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|