C12H13F3N2O — CID 105208035
[3,4-dihydro-2H-pyran-5-yl-(3,4,5-trifluorophenyl)methyl]hydrazine (PubChem CID 105208035) has the molecular formula C12H13F3N2O and a molecular weight of 258.24 g/mol. Its IUPAC name is [3,4-dihydro-2H-pyran-5-yl-(3,4,5-trifluorophenyl)methyl]hydrazine.
| Compound Name | [3,4-dihydro-2H-pyran-5-yl-(3,4,5-trifluorophenyl)methyl]hydrazine |
|---|---|
| PubChem CID | 105208035 |
| Molecular Formula | C12H13F3N2O |
| Molecular Weight | 258.24 g/mol |
| Exact Mass | 258.10 |
| IUPAC Name | [3,4-dihydro-2H-pyran-5-yl-(3,4,5-trifluorophenyl)methyl]hydrazine |
| SMILES | NNC(C1=COCCC1)c1cc(F)c(F)c(F)c1 |
| InChI | InChI=1S/C12H13F3N2O/c13-9-4-8(5-10(14)11(9)15)12(17-16)7-2-1-3-18-6-7/h4-6,12,17H,1-3,16H2 |
| InChIKey | FVYDWKNIUFJVEV-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.24 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|