C13H18N2OS — CID 105333174
[3,4-dihydro-2H-pyran-5-yl-(2-methylsulfanylphenyl)methyl]hydrazine (PubChem CID 105333174) has the molecular formula C13H18N2OS and a molecular weight of 250.37 g/mol. Its IUPAC name is [3,4-dihydro-2H-pyran-5-yl-(2-methylsulfanylphenyl)methyl]hydrazine.
| Compound Name | [3,4-dihydro-2H-pyran-5-yl-(2-methylsulfanylphenyl)methyl]hydrazine |
|---|---|
| PubChem CID | 105333174 |
| Molecular Formula | C13H18N2OS |
| Molecular Weight | 250.37 g/mol |
| Exact Mass | 250.11 |
| IUPAC Name | [3,4-dihydro-2H-pyran-5-yl-(2-methylsulfanylphenyl)methyl]hydrazine |
| SMILES | CSc1ccccc1C(NN)C1=COCCC1 |
| InChI | InChI=1S/C13H18N2OS/c1-17-12-7-3-2-6-11(12)13(15-14)10-5-4-8-16-9-10/h2-3,6-7,9,13,15H,4-5,8,14H2,1H3 |
| InChIKey | ZLOLHDWMNOQMCC-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.37 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|